Determine the necessary mass, volume, or concentration for preparing a solution.
Basic Description
| Synonyms | Tri-m-tolylphosphine | 6224-63-1 | Tri(m-tolyl)phosphine | Tris(3-methylphenyl)phosphine | Phosphine, tris(3-methylphenyl)- | Tris(m-tolyl)phosphine | tris(3-methylphenyl)phosphane | Phosphine, tri-m-tolyl- | Tris(3-tolyl)phosphine | SAQ9Z5ZSC8 | MFCD00008532 | TRI-M-TOLYL-PHO |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
AI Insight
Names and Identifiers
| Pubchem Sid | 504755458 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755458 |
| IUPAC Name | tris(3-methylphenyl)phosphane |
| INCHI | InChI=1S/C21H21P/c1-16-7-4-10-19(13-16)22(20-11-5-8-17(2)14-20)21-12-6-9-18(3)15-21/h4-15H,1-3H3 |
| InChi Key | LFNXCUNDYSYVJY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)P(C2=CC=CC(=C2)C)C3=CC=CC(=C3)C |
| Isomeric SMILES | CC1=CC(=CC=C1)P(C2=CC=CC(=C2)C)C3=CC=CC(=C3)C |
| WGK Germany | 3 |
| PubChem CID | 80362 |
| Molecular Weight | 304.37 |
| Beilstein | 658863 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 L1627065 |
Certificate of Analysis | Jul 11, 2022 | T141391 |
Chemical and Physical Properties
| Melt Point(°C) | 97-99°C |
|---|---|
| Molecular Weight | 304.400 g/mol |
| XLogP3 | 5.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 3 |
| Exact Mass | 304.138 Da |
| Monoisotopic Mass | 304.138 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 286.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Safety and Hazards(GHS)
| WGK Germany | 3 |
|---|
Specifications
Solution Calculators
Reviews
Customer Reviews
We have obtained your location, but we do not collect data on your location. Do we accept redirection to the corresponding region based on your location?