Amino Acids

Shop By
View as List Grid

4 Items

Set Descending Direction
  1. D-Aspartic acid, Excitatory amino acid transporter 1;Excitatory amino acid transporter 2;Excitatory amino acid transporter 3;Excitatory amino acid transporter 4;Excitatory amino acid transporter 5;Agonist of GluN1;Agonist of GluN2A;Agonist of GluN2B;Agonist of GluN2C;Agon
    Cas#: 1783-96-6        Compound CID:  83887
    Formula:  C4H7NO4        Molecular Weight: 133.10
    IUPAC Name: (2R)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-UWTATZPHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m1/s1
    Synonyms: 2,2'-methanediylbis(1H-benzimidazole) | 6-benzyloxy-1H-indole | C4H7NO4 | delta-aspartate | SR-01000597731 | C00402 |...
  2. L-Histidine, Peptide transporter 3;Peptide transporter 4;Sodium-coupled neutral amino acid transporter 5
    Cas#: 71-00-1        Compound CID:  6274
    Formula:  C6H9N3O2        Molecular Weight: 155.15
    IUPAC Name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid
    SMILES: C1=C(NC=N1)CC(C(=O)O)N
    InChIKey: HNDVDQJCIGZPNO-YFKPBYRVSA-N
    InChI: InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1
    Synonyms: (S)-2-Amino-3-(4-imidazolyl)propionic acid | glyoxaline-5-alanine | NSC 137773 | L-2-Amino-3-(4-imidazolyl)propionic ...
  3. L-Histidine, Peptide transporter 3;Peptide transporter 4;Sodium-coupled neutral amino acid transporter 5
    Cas#: 71-00-1        Compound CID:  6274
    Formula:  C6H9N3O2        Molecular Weight: 155.15
    IUPAC Name: (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid
    SMILES: C1=C(NC=N1)CC(C(=O)O)N
    InChIKey: HNDVDQJCIGZPNO-YFKPBYRVSA-N
    InChI: InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1
    Synonyms: (S)-2-Amino-3-(4-imidazolyl)propionic acid | NSC 137773 | H-His-OH
  4. Poly(L-aspartic acid)
    Cas#: 25608-40-6        Compound CID:  5960
    Formula:  (C4H5NO3)n       
    IUPAC Name: (2S)-2-aminobutanedioic acid
    SMILES: C(C(C(=O)O)N)C(=O)O
    InChIKey: CKLJMWTZIZZHCS-REOHCLBHSA-N
    InChI: InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1
    Synonyms: Polyasparticacid(PASP) | polyasparticacid
per page

We have obtained your location, but we do not collect data on your location. Do we accept redirection to the corresponding region based on your location?